C30H49N3 — CID 118616738
(4S,5R)-2-N-[(E)-2-aminoethenyl]-2-N-(4-tert-butylcyclohexa-2,4-dien-1-yl)-1-N-[(1R,4S)-4-tert-butylcyclohex-2-en-1-yl]-4,5-dimethylcyclohexene-1,2-diamine (PubChem CID 118616738) has the molecular formula C30H49N3 and a molecular weight of 451.74 g/mol. Its IUPAC name is (4S,5R)-2-N-[(E)-2-aminoethenyl]-2-N-(4-tert-butylcyclohexa-2,4-dien-1-yl)-1-N-[(1R,4S)-4-tert-butylcyclohex-2-en-1-yl]-4,5-dimethylcyclohexene-1,2-diamine.
| Compound Name | (4S,5R)-2-N-[(E)-2-aminoethenyl]-2-N-(4-tert-butylcyclohexa-2,4-dien-1-yl)-1-N-[(1R,4S)-4-tert-butylcyclohex-2-en-1-yl]-4,5-dimethylcyclohexene-1,2-diamine |
|---|---|
| PubChem CID | 118616738 |
| Molecular Formula | C30H49N3 |
| Molecular Weight | 451.74 g/mol |
| Exact Mass | 451.39 |
| IUPAC Name | (4S,5R)-2-N-[(E)-2-aminoethenyl]-2-N-(4-tert-butylcyclohexa-2,4-dien-1-yl)-1-N-[(1R,4S)-4-tert-butylcyclohex-2-en-1-yl]-4,5-dimethylcyclohexene-1,2-diamine |
| SMILES | C[C@@H]1CC(N[C@H]2C=C[C@@H](C(C)(C)C)CC2)=C(N(/C=C/N)C2C=CC(C(C)(C)C)=CC2)C[C@@H]1C |
| InChI | InChI=1S/C30H49N3/c1-21-19-27(32-25-13-9-23(10-14-25)29(3,4)5)28(20-22(21)2)33(18-17-31)26-15-11-24(12-16-26)30(6,7)8/h9,11-13,15,17-18,21-23,25-26,32H,10,14,16,19-20,31H2,1-8H3/b18-17+/t21-,22+,23-,25+,26?/m1/s1 |
| InChIKey | OPNSYFDALATCEP-IVOWPERBSA-N |
| XLogP | 7.27 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.74 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|