C18H27N — CID 118616845
6-[(Z)-but-1-enyl]-4-ethyl-3-[(3Z,5Z)-hepta-3,5-dien-2-yl]-3,4-dihydropyridine (PubChem CID 118616845) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is 6-[(Z)-but-1-enyl]-4-ethyl-3-[(3Z,5Z)-hepta-3,5-dien-2-yl]-3,4-dihydropyridine.
| Compound Name | 6-[(Z)-but-1-enyl]-4-ethyl-3-[(3Z,5Z)-hepta-3,5-dien-2-yl]-3,4-dihydropyridine |
|---|---|
| PubChem CID | 118616845 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 6-[(Z)-but-1-enyl]-4-ethyl-3-[(3Z,5Z)-hepta-3,5-dien-2-yl]-3,4-dihydropyridine |
| SMILES | C/C=C\C=C/C(C)C1C=NC(/C=C\CC)=CC1CC |
| InChI | InChI=1S/C18H27N/c1-5-8-10-11-15(4)18-14-19-17(12-9-6-2)13-16(18)7-3/h5,8-16,18H,6-7H2,1-4H3/b8-5-,11-10-,12-9- |
| InChIKey | AQEOIZUHIAVMSH-GUXOZVKVSA-N |
| XLogP | 5.33 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|