C15H22N2 — CID 118616847
N'-[(1E,4Z,7E)-6-methylidene-7-[(Z)-prop-1-enyl]deca-1,4,7-trienyl]methanimidamide (PubChem CID 118616847) has the molecular formula C15H22N2 and a molecular weight of 230.35 g/mol. Its IUPAC name is N'-[(1E,4Z,7E)-6-methylidene-7-[(Z)-prop-1-enyl]deca-1,4,7-trienyl]methanimidamide.
| Compound Name | N'-[(1E,4Z,7E)-6-methylidene-7-[(Z)-prop-1-enyl]deca-1,4,7-trienyl]methanimidamide |
|---|---|
| PubChem CID | 118616847 |
| Molecular Formula | C15H22N2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | N'-[(1E,4Z,7E)-6-methylidene-7-[(Z)-prop-1-enyl]deca-1,4,7-trienyl]methanimidamide |
| SMILES | C=C(/C=C\C/C=C/N=C/N)C(/C=C\C)=C/CC |
| InChI | InChI=1S/C15H22N2/c1-4-9-15(10-5-2)14(3)11-7-6-8-12-17-13-16/h4,7-13H,3,5-6H2,1-2H3,(H2,16,17)/b9-4-,11-7-,12-8+,15-10+ |
| InChIKey | MMEJBZICJQWMOU-YKIPSHGUSA-N |
| XLogP | 3.90 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|