C29H51N3 — CID 118616915
(Z)-1-N'-[(1R,4R)-4-butan-2-ylcyclohex-2-en-1-yl]-1-N'-[(2S)-1-[(Z,2R)-2-butan-2-ylpent-3-enyl]-2,3,4-trimethylcyclopent-3-en-1-yl]ethene-1,1,2-triamine (PubChem CID 118616915) has the molecular formula C29H51N3 and a molecular weight of 441.75 g/mol. Its IUPAC name is (Z)-1-N'-[(1R,4R)-4-butan-2-ylcyclohex-2-en-1-yl]-1-N'-[(2S)-1-[(Z,2R)-2-butan-2-ylpent-3-enyl]-2,3,4-trimethylcyclopent-3-en-1-yl]ethene-1,1,2-triamine.
| Compound Name | (Z)-1-N'-[(1R,4R)-4-butan-2-ylcyclohex-2-en-1-yl]-1-N'-[(2S)-1-[(Z,2R)-2-butan-2-ylpent-3-enyl]-2,3,4-trimethylcyclopent-3-en-1-yl]ethene-1,1,2-triamine |
|---|---|
| PubChem CID | 118616915 |
| Molecular Formula | C29H51N3 |
| Molecular Weight | 441.75 g/mol |
| Exact Mass | 441.41 |
| IUPAC Name | (Z)-1-N'-[(1R,4R)-4-butan-2-ylcyclohex-2-en-1-yl]-1-N'-[(2S)-1-[(Z,2R)-2-butan-2-ylpent-3-enyl]-2,3,4-trimethylcyclopent-3-en-1-yl]ethene-1,1,2-triamine |
| SMILES | C/C=C\[C@H](CC1(N(/C(N)=C\N)[C@H]2C=C[C@@H](C(C)CC)CC2)CC(C)=C(C)[C@@H]1C)C(C)CC |
| InChI | InChI=1S/C29H51N3/c1-9-12-26(21(5)11-3)18-29(17-22(6)23(7)24(29)8)32(28(31)19-30)27-15-13-25(14-16-27)20(4)10-2/h9,12-13,15,19-21,24-27H,10-11,14,16-18,30-31H2,1-8H3/b12-9-,28-19-/t20?,21?,24-,25+,26+,27-,29?/m0/s1 |
| InChIKey | NSFCQLILKQDZHD-PCESQZNWSA-N |
| XLogP | 7.13 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.75 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|