C30H47N3 — CID 118616920
(E)-[(5S,6S)-6-methyl-5-propan-2-yl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]-3-[(1R,4R)-4-propan-2-ylcyclohex-2-en-1-yl]-4,5,6,7-tetrahydrobenzimidazol-2-ylidene]methanamine (PubChem CID 118616920) has the molecular formula C30H47N3 and a molecular weight of 449.73 g/mol. Its IUPAC name is (E)-[(5S,6S)-6-methyl-5-propan-2-yl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]-3-[(1R,4R)-4-propan-2-ylcyclohex-2-en-1-yl]-4,5,6,7-tetrahydrobenzimidazol-2-ylidene]methanamine.
| Compound Name | (E)-[(5S,6S)-6-methyl-5-propan-2-yl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]-3-[(1R,4R)-4-propan-2-ylcyclohex-2-en-1-yl]-4,5,6,7-tetrahydrobenzimidazol-2-ylidene]methanamine |
|---|---|
| PubChem CID | 118616920 |
| Molecular Formula | C30H47N3 |
| Molecular Weight | 449.73 g/mol |
| Exact Mass | 449.38 |
| IUPAC Name | (E)-[(5S,6S)-6-methyl-5-propan-2-yl-1-[(1R)-4-propan-2-ylcyclohexa-2,4-dien-1-yl]-3-[(1R,4R)-4-propan-2-ylcyclohex-2-en-1-yl]-4,5,6,7-tetrahydrobenzimidazol-2-ylidene]methanamine |
| SMILES | CC(C)C1=CC[C@@H](N2C3=C(C[C@@H](C(C)C)[C@@H](C)C3)N([C@H]3C=C[C@@H](C(C)C)CC3)/C2=C\N)C=C1 |
| InChI | InChI=1S/C30H47N3/c1-19(2)23-8-12-25(13-9-23)32-28-16-22(7)27(21(5)6)17-29(28)33(30(32)18-31)26-14-10-24(11-15-26)20(3)4/h8-10,12,14,18-22,24-27H,11,13,15-17,31H2,1-7H3/b30-18-/t22-,24+,25-,26-,27-/m0/s1 |
| InChIKey | AOGTVWJCRTXWAU-LIHCUVSMSA-N |
| XLogP | 7.18 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.73 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|