C16H17NO3S — CID 118617127
5-[(3,4,5-trimethoxyphenyl)methyl]-4H-thieno[3,2-b]pyrrole (PubChem CID 118617127) has the molecular formula C16H17NO3S and a molecular weight of 303.38 g/mol. Its IUPAC name is 5-[(3,4,5-trimethoxyphenyl)methyl]-4H-thieno[3,2-b]pyrrole.
| Compound Name | 5-[(3,4,5-trimethoxyphenyl)methyl]-4H-thieno[3,2-b]pyrrole |
|---|---|
| PubChem CID | 118617127 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 5-[(3,4,5-trimethoxyphenyl)methyl]-4H-thieno[3,2-b]pyrrole |
| SMILES | COc1cc(Cc2cc3sccc3[nH]2)cc(OC)c1OC |
| InChI | InChI=1S/C16H17NO3S/c1-18-13-7-10(8-14(19-2)16(13)20-3)6-11-9-15-12(17-11)4-5-21-15/h4-5,7-9,17H,6H2,1-3H3 |
| InChIKey | UKKMXZVLSLWTBQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 43.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |