About 7-bromo-3-ethoxypyrido[1,2-a]pyrimidin-4-one
7-bromo-3-ethoxypyrido[1,2-a]pyrimidin-4-one (PubChem CID 118617211) has the molecular formula C10H9BrN2O2
and a molecular weight of 269.10 g/mol. Its IUPAC name is 7-bromo-3-ethoxypyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-bromo-3-ethoxypyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 118617211 |
| Molecular Formula | C10H9BrN2O2 |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 7-bromo-3-ethoxypyrido[1,2-a]pyrimidin-4-one |
| SMILES | CCOc1cnc2ccc(Br)cn2c1=O |
| InChI | InChI=1S/C10H9BrN2O2/c1-2-15-8-5-12-9-4-3-7(11)6-13(9)10(8)14/h3-6H,2H2,1H3 |
| InChIKey | NTJLZWRBDUOOFI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-bromo-3-ethoxypyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3-ethoxypyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 7-bromo-3-ethoxypyrido[1,2-a]pyrimidin-4-one (CID 118617211) is 7-bromo-3-ethoxypyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 7-bromo-3-ethoxypyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 7-bromo-3-ethoxypyrido[1,2-a]pyrimidin-4-one is CCOc1cnc2ccc(Br)cn2c1=O.
What is the InChIKey of 7-bromo-3-ethoxypyrido[1,2-a]pyrimidin-4-one?
The InChIKey is NTJLZWRBDUOOFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN2O2/c1-2-15-8-5-12-9-4-3-7(11)6-13(9)10(8)14/h3-6H,2H2,1H3.
What are the key properties of 7-bromo-3-ethoxypyrido[1,2-a]pyrimidin-4-one?
7-bromo-3-ethoxypyrido[1,2-a]pyrimidin-4-one has a molecular weight of 269.10 g/mol, XLogP of 1.86, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3-ethoxypyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 118617211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).