C7H17N3S — CID 118617242
(Z)-3-(aminomethylsulfanyl)-1-N,1-N,2-N-trimethylprop-2-ene-1,2-diamine (PubChem CID 118617242) has the molecular formula C7H17N3S and a molecular weight of 175.30 g/mol. Its IUPAC name is (Z)-3-(aminomethylsulfanyl)-1-N,1-N,2-N-trimethylprop-2-ene-1,2-diamine.
| Compound Name | (Z)-3-(aminomethylsulfanyl)-1-N,1-N,2-N-trimethylprop-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 118617242 |
| Molecular Formula | C7H17N3S |
| Molecular Weight | 175.30 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | (Z)-3-(aminomethylsulfanyl)-1-N,1-N,2-N-trimethylprop-2-ene-1,2-diamine |
| SMILES | CN/C(=C\SCN)CN(C)C |
| InChI | InChI=1S/C7H17N3S/c1-9-7(4-10(2)3)5-11-6-8/h5,9H,4,6,8H2,1-3H3/b7-5- |
| InChIKey | BZTCCJOMFPFFMF-ALCCZGGFSA-N |
| XLogP | 0.26 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.30 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|