About N-ethyl-N-methyl-2-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)ethanamine
N-ethyl-N-methyl-2-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)ethanamine (PubChem CID 118617263) has the molecular formula C9H18N2S
and a molecular weight of 186.32 g/mol. Its IUPAC name is N-ethyl-N-methyl-2-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)ethanamine.
Molecular Properties
| Compound Name | N-ethyl-N-methyl-2-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)ethanamine |
| PubChem CID | 118617263 |
| Molecular Formula | C9H18N2S |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | N-ethyl-N-methyl-2-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)ethanamine |
| SMILES | CCN(C)CCC1=CSC(C)N1 |
| InChI | InChI=1S/C9H18N2S/c1-4-11(3)6-5-9-7-12-8(2)10-9/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | CSTXCPARDKRKTN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-N-methyl-2-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methyl-2-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)ethanamine?
The IUPAC name of N-ethyl-N-methyl-2-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)ethanamine (CID 118617263) is N-ethyl-N-methyl-2-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)ethanamine.
What is the SMILES notation for N-ethyl-N-methyl-2-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)ethanamine?
The canonical SMILES for N-ethyl-N-methyl-2-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)ethanamine is CCN(C)CCC1=CSC(C)N1.
What is the InChIKey of N-ethyl-N-methyl-2-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)ethanamine?
The InChIKey is CSTXCPARDKRKTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2S/c1-4-11(3)6-5-9-7-12-8(2)10-9/h7-8,10H,4-6H2,1-3H3.
What are the key properties of N-ethyl-N-methyl-2-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)ethanamine?
N-ethyl-N-methyl-2-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)ethanamine has a molecular weight of 186.32 g/mol, XLogP of 1.85, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methyl-2-(2-methyl-2,3-dihydro-1,3-thiazol-4-yl)ethanamine is sourced from PubChem (CID 118617263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).