About 1,1,2-trimethylspiro[3H-isoquinoline-4,1'-cyclopropane]
1,1,2-trimethylspiro[3H-isoquinoline-4,1'-cyclopropane] (PubChem CID 118617410) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 1,1,2-trimethylspiro[3H-isoquinoline-4,1'-cyclopropane].
Molecular Properties
| Compound Name | 1,1,2-trimethylspiro[3H-isoquinoline-4,1'-cyclopropane] |
| PubChem CID | 118617410 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 1,1,2-trimethylspiro[3H-isoquinoline-4,1'-cyclopropane] |
| SMILES | CN1CC2(CC2)c2ccccc2C1(C)C |
| InChI | InChI=1S/C14H19N/c1-13(2)11-6-4-5-7-12(11)14(8-9-14)10-15(13)3/h4-7H,8-10H2,1-3H3 |
| InChIKey | QWAUCCFTEXQOSV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,1,2-trimethylspiro[3H-isoquinoline-4,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2-trimethylspiro[3H-isoquinoline-4,1'-cyclopropane]?
The IUPAC name of 1,1,2-trimethylspiro[3H-isoquinoline-4,1'-cyclopropane] (CID 118617410) is 1,1,2-trimethylspiro[3H-isoquinoline-4,1'-cyclopropane].
What is the SMILES notation for 1,1,2-trimethylspiro[3H-isoquinoline-4,1'-cyclopropane]?
The canonical SMILES for 1,1,2-trimethylspiro[3H-isoquinoline-4,1'-cyclopropane] is CN1CC2(CC2)c2ccccc2C1(C)C.
What is the InChIKey of 1,1,2-trimethylspiro[3H-isoquinoline-4,1'-cyclopropane]?
The InChIKey is QWAUCCFTEXQOSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-13(2)11-6-4-5-7-12(11)14(8-9-14)10-15(13)3/h4-7H,8-10H2,1-3H3.
What are the key properties of 1,1,2-trimethylspiro[3H-isoquinoline-4,1'-cyclopropane]?
1,1,2-trimethylspiro[3H-isoquinoline-4,1'-cyclopropane] has a molecular weight of 201.31 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2-trimethylspiro[3H-isoquinoline-4,1'-cyclopropane] is sourced from PubChem (CID 118617410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).