C25H25FN6O4 — CID 118618210
N-[2-(4-fluoro-2-methoxy-5-nitroanilino)-4-(1-methylindol-3-yl)pyrimidin-5-yl]-N,2-dimethylpropanamide (PubChem CID 118618210) has the molecular formula C25H25FN6O4 and a molecular weight of 492.51 g/mol. Its IUPAC name is N-[2-(4-fluoro-2-methoxy-5-nitroanilino)-4-(1-methylindol-3-yl)pyrimidin-5-yl]-N,2-dimethylpropanamide.
| Compound Name | N-[2-(4-fluoro-2-methoxy-5-nitroanilino)-4-(1-methylindol-3-yl)pyrimidin-5-yl]-N,2-dimethylpropanamide |
|---|---|
| PubChem CID | 118618210 |
| Molecular Formula | C25H25FN6O4 |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | N-[2-(4-fluoro-2-methoxy-5-nitroanilino)-4-(1-methylindol-3-yl)pyrimidin-5-yl]-N,2-dimethylpropanamide |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1Nc1ncc(N(C)C(=O)C(C)C)c(-c2cn(C)c3ccccc23)n1 |
| InChI | InChI=1S/C25H25FN6O4/c1-14(2)24(33)31(4)21-12-27-25(28-18-11-20(32(34)35)17(26)10-22(18)36-5)29-23(21)16-13-30(3)19-9-7-6-8-15(16)19/h6-14H,1-5H3,(H,27,28,29) |
| InChIKey | JIYHYPGOJRWNAZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|