C15H20O3 — CID 118618577
2,9-dimethyl-11-propan-2-yl-4-oxatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione (PubChem CID 118618577) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 2,9-dimethyl-11-propan-2-yl-4-oxatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione.
| Compound Name | 2,9-dimethyl-11-propan-2-yl-4-oxatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 118618577 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 2,9-dimethyl-11-propan-2-yl-4-oxatricyclo[5.2.2.02,6]undec-8-ene-3,5-dione |
| SMILES | CC1=CC2C(C(C)C)CC1C1(C)C(=O)OC(=O)C21 |
| InChI | InChI=1S/C15H20O3/c1-7(2)9-6-11-8(3)5-10(9)12-13(16)18-14(17)15(11,12)4/h5,7,9-12H,6H2,1-4H3 |
| InChIKey | LCHORSRDEXDIIP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|