About N-[[(1R,2R)-2-(4-methylpentyl)cyclopropyl]methyl]propan-2-amine
N-[[(1R,2R)-2-(4-methylpentyl)cyclopropyl]methyl]propan-2-amine (PubChem CID 118618598) has the molecular formula C13H27N
and a molecular weight of 197.37 g/mol. Its IUPAC name is N-[[(1R,2R)-2-(4-methylpentyl)cyclopropyl]methyl]propan-2-amine.
Molecular Properties
| Compound Name | N-[[(1R,2R)-2-(4-methylpentyl)cyclopropyl]methyl]propan-2-amine |
| PubChem CID | 118618598 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | N-[[(1R,2R)-2-(4-methylpentyl)cyclopropyl]methyl]propan-2-amine |
| SMILES | CC(C)CCC[C@@H]1C[C@H]1CNC(C)C |
| InChI | InChI=1S/C13H27N/c1-10(2)6-5-7-12-8-13(12)9-14-11(3)4/h10-14H,5-9H2,1-4H3/t12-,13+/m1/s1 |
| InChIKey | XOIBCYDUVXNHTD-OLZOCXBDSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[[(1R,2R)-2-(4-methylpentyl)cyclopropyl]methyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1R,2R)-2-(4-methylpentyl)cyclopropyl]methyl]propan-2-amine?
The IUPAC name of N-[[(1R,2R)-2-(4-methylpentyl)cyclopropyl]methyl]propan-2-amine (CID 118618598) is N-[[(1R,2R)-2-(4-methylpentyl)cyclopropyl]methyl]propan-2-amine.
What is the SMILES notation for N-[[(1R,2R)-2-(4-methylpentyl)cyclopropyl]methyl]propan-2-amine?
The canonical SMILES for N-[[(1R,2R)-2-(4-methylpentyl)cyclopropyl]methyl]propan-2-amine is CC(C)CCC[C@@H]1C[C@H]1CNC(C)C.
What is the InChIKey of N-[[(1R,2R)-2-(4-methylpentyl)cyclopropyl]methyl]propan-2-amine?
The InChIKey is XOIBCYDUVXNHTD-OLZOCXBDSA-N. The full InChI is InChI=1S/C13H27N/c1-10(2)6-5-7-12-8-13(12)9-14-11(3)4/h10-14H,5-9H2,1-4H3/t12-,13+/m1/s1.
What are the key properties of N-[[(1R,2R)-2-(4-methylpentyl)cyclopropyl]methyl]propan-2-amine?
N-[[(1R,2R)-2-(4-methylpentyl)cyclopropyl]methyl]propan-2-amine has a molecular weight of 197.37 g/mol, XLogP of 3.45, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1R,2R)-2-(4-methylpentyl)cyclopropyl]methyl]propan-2-amine is sourced from PubChem (CID 118618598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).