C20H25NO4S — CID 118619054
[5-(3-ethylsulfonylpropoxy)-6-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaen-14-yl]methanol (PubChem CID 118619054) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is [5-(3-ethylsulfonylpropoxy)-6-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaen-14-yl]methanol.
| Compound Name | [5-(3-ethylsulfonylpropoxy)-6-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaen-14-yl]methanol |
|---|---|
| PubChem CID | 118619054 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | [5-(3-ethylsulfonylpropoxy)-6-azatricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaen-14-yl]methanol |
| SMILES | CCS(=O)(=O)CCCOc1ccc2c(n1)CCCc1ccc(CO)cc1-2 |
| InChI | InChI=1S/C20H25NO4S/c1-2-26(23,24)12-4-11-25-20-10-9-17-18-13-15(14-22)7-8-16(18)5-3-6-19(17)21-20/h7-10,13,22H,2-6,11-12,14H2,1H3 |
| InChIKey | BWPUHEYFPXZKLJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|