C34H40O6S — CID 118619353
(E)-3-[4-[[13-[(1,1-dihydroxythian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]hex-4-enoic acid (PubChem CID 118619353) has the molecular formula C34H40O6S and a molecular weight of 576.76 g/mol. Its IUPAC name is (E)-3-[4-[[13-[(1,1-dihydroxythian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]hex-4-enoic acid.
| Compound Name | (E)-3-[4-[[13-[(1,1-dihydroxythian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]hex-4-enoic acid |
|---|---|
| PubChem CID | 118619353 |
| Molecular Formula | C34H40O6S |
| Molecular Weight | 576.76 g/mol |
| Exact Mass | 576.25 |
| IUPAC Name | (E)-3-[4-[[13-[(1,1-dihydroxythian-4-yl)methoxy]-4-tricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaenyl]methoxy]phenyl]hex-4-enoic acid |
| SMILES | C/C=C/C(CC(=O)O)c1ccc(OCc2ccc3c(c2)-c2ccc(OCC4CCS(O)(O)CC4)cc2CCC3)cc1 |
| InChI | InChI=1S/C34H40O6S/c1-2-4-28(21-34(35)36)26-9-11-30(12-10-26)39-23-25-7-8-27-5-3-6-29-20-31(13-14-32(29)33(27)19-25)40-22-24-15-17-41(37,38)18-16-24/h2,4,7-14,19-20,24,28,37-38H,3,5-6,15-18,21-23H2,1H3,(H,35,36)/b4-2+ |
| InChIKey | NWGLVSNZHOMTQO-DUXPYHPUSA-N |
| XLogP | 8.10 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.76 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|