C24H27FO5S — CID 118619391
methyl 5-fluoro-13-[(4-methyl-1,1-dioxothian-4-yl)methoxy]tricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene-4-carboxylate (PubChem CID 118619391) has the molecular formula C24H27FO5S and a molecular weight of 446.54 g/mol. Its IUPAC name is methyl 5-fluoro-13-[(4-methyl-1,1-dioxothian-4-yl)methoxy]tricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene-4-carboxylate.
| Compound Name | methyl 5-fluoro-13-[(4-methyl-1,1-dioxothian-4-yl)methoxy]tricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene-4-carboxylate |
|---|---|
| PubChem CID | 118619391 |
| Molecular Formula | C24H27FO5S |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | methyl 5-fluoro-13-[(4-methyl-1,1-dioxothian-4-yl)methoxy]tricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,12,14-hexaene-4-carboxylate |
| SMILES | COC(=O)c1cc2c(cc1F)CCCc1cc(OCC3(C)CCS(=O)(=O)CC3)ccc1-2 |
| InChI | InChI=1S/C24H27FO5S/c1-24(8-10-31(27,28)11-9-24)15-30-18-6-7-19-16(12-18)4-3-5-17-13-22(25)21(14-20(17)19)23(26)29-2/h6-7,12-14H,3-5,8-11,15H2,1-2H3 |
| InChIKey | PBYIOJUFPXGTKD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |