C58H65BrN6O4 — CID 118619713
ethyl 7-[2,3-bis(4-methylphenyl)pyrrolo[2,3-b]pyrazin-5-yl]heptanoate;ethyl 7-[7-bromo-2,3-bis(4-methylphenyl)pyrrolo[2,3-b]pyrazin-5-yl]heptanoate (PubChem CID 118619713) has the molecular formula C58H65BrN6O4 and a molecular weight of 990.10 g/mol. Its IUPAC name is ethyl 7-[2,3-bis(4-methylphenyl)pyrrolo[2,3-b]pyrazin-5-yl]heptanoate;ethyl 7-[7-bromo-2,3-bis(4-methylphenyl)pyrrolo[2,3-b]pyrazin-5-yl]heptanoate.
| Compound Name | ethyl 7-[2,3-bis(4-methylphenyl)pyrrolo[2,3-b]pyrazin-5-yl]heptanoate;ethyl 7-[7-bromo-2,3-bis(4-methylphenyl)pyrrolo[2,3-b]pyrazin-5-yl]heptanoate |
|---|---|
| PubChem CID | 118619713 |
| Molecular Formula | C58H65BrN6O4 |
| Molecular Weight | 990.10 g/mol |
| Exact Mass | 988.43 |
| IUPAC Name | ethyl 7-[2,3-bis(4-methylphenyl)pyrrolo[2,3-b]pyrazin-5-yl]heptanoate;ethyl 7-[7-bromo-2,3-bis(4-methylphenyl)pyrrolo[2,3-b]pyrazin-5-yl]heptanoate |
| SMILES | CCOC(=O)CCCCCCn1cc(Br)c2nc(-c3ccc(C)cc3)c(-c3ccc(C)cc3)nc21.CCOC(=O)CCCCCCn1ccc2nc(-c3ccc(C)cc3)c(-c3ccc(C)cc3)nc21 |
| InChI | InChI=1S/C29H32BrN3O2.C29H33N3O2/c1-4-35-25(34)9-7-5-6-8-18-33-19-24(30)28-29(33)32-27(23-16-12-21(3)13-17-23)26(31-28)22-14-10-20(2)11-15-22;1-4-34-26(33)9-7-5-6-8-19-32-20-18-25-29(32)31-28(24-16-12-22(3)13-17-24)27(30-25)23-14-10-21(2)11-15-23/h10-17,19H,4-9,18H2,1-3H3;10-18,20H,4-9,19H2,1-3H3 |
| InChIKey | CFWWIBALXLUACF-UHFFFAOYSA-N |
| XLogP | 14.55 |
| TPSA | 114.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 990.10 |
| LogP ≤ 5 | 14.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|