C52H74F4NO7+ — CID 118620276
bis[[(1R,4S,5S)-4-[4-(1,1-difluorooctyl)-2,6-dimethoxyphenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]-oxoazanium (PubChem CID 118620276) has the molecular formula C52H74F4NO7+ and a molecular weight of 901.16 g/mol. Its IUPAC name is bis[[(1R,4S,5S)-4-[4-(1,1-difluorooctyl)-2,6-dimethoxyphenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]-oxoazanium.
| Compound Name | bis[[(1R,4S,5S)-4-[4-(1,1-difluorooctyl)-2,6-dimethoxyphenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]-oxoazanium |
|---|---|
| PubChem CID | 118620276 |
| Molecular Formula | C52H74F4NO7+ |
| Molecular Weight | 901.16 g/mol |
| Exact Mass | 900.54 |
| IUPAC Name | bis[[(1R,4S,5S)-4-[4-(1,1-difluorooctyl)-2,6-dimethoxyphenyl]-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methoxy]-oxoazanium |
| SMILES | CCCCCCCC(F)(F)c1cc(OC)c([C@H]2C=C(CO[N+](=O)OCC3=C[C@H](c4c(OC)cc(C(F)(F)CCCCCCC)cc4OC)[C@@H]4C[C@@H]3C4(C)C)[C@@H]3C[C@@H]2C3(C)C)c(OC)c1 |
| InChI | InChI=1S/C52H74F4NO7/c1-11-13-15-17-19-21-51(53,54)35-25-43(59-7)47(44(26-35)60-8)37-23-33(39-29-41(37)49(39,3)4)31-63-57(58)64-32-34-24-38(42-30-40(34)50(42,5)6)48-45(61-9)27-36(28-46(48)62-10)52(55,56)22-20-18-16-14-12-2/h23-28,37-42H,11-22,29-32H2,1-10H3/q+1/t37-,38-,39-,40-,41-,42-/m0/s1 |
| InChIKey | ZMKWUMLWNKZFTR-UJKKYYSESA-N |
| XLogP | 14.34 |
| TPSA | 75.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.16 |
| LogP ≤ 5 | 14.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|