C28H39NO9 — CID 118620286
4-[2-[(1R,2R,5R)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxy-5-(2-methyl-8-nitrooxyoctan-2-yl)phenoxy]-4-oxobutanoic acid (PubChem CID 118620286) has the molecular formula C28H39NO9 and a molecular weight of 533.62 g/mol. Its IUPAC name is 4-[2-[(1R,2R,5R)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxy-5-(2-methyl-8-nitrooxyoctan-2-yl)phenoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[(1R,2R,5R)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxy-5-(2-methyl-8-nitrooxyoctan-2-yl)phenoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 118620286 |
| Molecular Formula | C28H39NO9 |
| Molecular Weight | 533.62 g/mol |
| Exact Mass | 533.26 |
| IUPAC Name | 4-[2-[(1R,2R,5R)-6,6-dimethyl-4-oxo-2-bicyclo[3.1.1]heptanyl]-3-hydroxy-5-(2-methyl-8-nitrooxyoctan-2-yl)phenoxy]-4-oxobutanoic acid |
| SMILES | CC(C)(CCCCCCO[N+](=O)[O-])c1cc(O)c([C@@H]2CC(=O)[C@@H]3C[C@H]2C3(C)C)c(OC(=O)CCC(=O)O)c1 |
| InChI | InChI=1S/C28H39NO9/c1-27(2,11-7-5-6-8-12-37-29(35)36)17-13-22(31)26(23(14-17)38-25(34)10-9-24(32)33)18-15-21(30)20-16-19(18)28(20,3)4/h13-14,18-20,31H,5-12,15-16H2,1-4H3,(H,32,33)/t18-,19-,20+/m1/s1 |
| InChIKey | SKZZZHUSRMRDRX-AQNXPRMDSA-N |
| XLogP | 5.32 |
| TPSA | 153.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|