C23H29F2NO7 — CID 118620336
5-nitrooxypentyl 2,2-difluoro-2-(1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl)acetate (PubChem CID 118620336) has the molecular formula C23H29F2NO7 and a molecular weight of 469.48 g/mol. Its IUPAC name is 5-nitrooxypentyl 2,2-difluoro-2-(1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl)acetate.
| Compound Name | 5-nitrooxypentyl 2,2-difluoro-2-(1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl)acetate |
|---|---|
| PubChem CID | 118620336 |
| Molecular Formula | C23H29F2NO7 |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 5-nitrooxypentyl 2,2-difluoro-2-(1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl)acetate |
| SMILES | CC1=CCC2C(C1)c1c(O)cc(C(F)(F)C(=O)OCCCCCO[N+](=O)[O-])cc1OC2(C)C |
| InChI | InChI=1S/C23H29F2NO7/c1-14-7-8-17-16(11-14)20-18(27)12-15(13-19(20)33-22(17,2)3)23(24,25)21(28)31-9-5-4-6-10-32-26(29)30/h7,12-13,16-17,27H,4-6,8-11H2,1-3H3 |
| InChIKey | GXGVJELEXRQSIH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|