About [5-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-5-methylhexyl] nitrate
[5-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-5-methylhexyl] nitrate (PubChem CID 118620599) has the molecular formula C19H29NO5
and a molecular weight of 351.44 g/mol. Its IUPAC name is [5-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-5-methylhexyl] nitrate.
Molecular Properties
| Compound Name | [5-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-5-methylhexyl] nitrate |
| PubChem CID | 118620599 |
| Molecular Formula | C19H29NO5 |
| Molecular Weight | 351.44 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | [5-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-5-methylhexyl] nitrate |
| SMILES | CC(C)(CCCCO[N+](=O)[O-])c1ccc([C@H]2CCC[C@@H](O)C2)c(O)c1 |
| InChI | InChI=1S/C19H29NO5/c1-19(2,10-3-4-11-25-20(23)24)15-8-9-17(18(22)13-15)14-6-5-7-16(21)12-14/h8-9,13-14,16,21-22H,3-7,10-12H2,1-2H3/t14-,16+/m0/s1 |
| InChIKey | VUEMWUQHTOIBMO-GOEBONIOSA-N |
| XLogP | 4.07 |
| TPSA | 92.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-5-methylhexyl] nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-5-methylhexyl] nitrate?
The IUPAC name of [5-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-5-methylhexyl] nitrate (CID 118620599) is [5-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-5-methylhexyl] nitrate.
What is the SMILES notation for [5-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-5-methylhexyl] nitrate?
The canonical SMILES for [5-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-5-methylhexyl] nitrate is CC(C)(CCCCO[N+](=O)[O-])c1ccc([C@H]2CCC[C@@H](O)C2)c(O)c1.
What is the InChIKey of [5-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-5-methylhexyl] nitrate?
The InChIKey is VUEMWUQHTOIBMO-GOEBONIOSA-N. The full InChI is InChI=1S/C19H29NO5/c1-19(2,10-3-4-11-25-20(23)24)15-8-9-17(18(22)13-15)14-6-5-7-16(21)12-14/h8-9,13-14,16,21-22H,3-7,10-12H2,1-2H3/t14-,16+/m0/s1.
What are the key properties of [5-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-5-methylhexyl] nitrate?
[5-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-5-methylhexyl] nitrate has a molecular weight of 351.44 g/mol, XLogP of 4.07, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[3-hydroxy-4-[(1S,3R)-3-hydroxycyclohexyl]phenyl]-5-methylhexyl] nitrate is sourced from PubChem (CID 118620599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).