C25H26O4 — CID 11862061
dipropan-2-yl (1R,2S,3R,4S,11R)-pentacyclo[9.6.0.01,4.05,10.012,17]heptadeca-5,7,9,12,14,16-hexaene-2,3-dicarboxylate (PubChem CID 11862061) has the molecular formula C25H26O4 and a molecular weight of 390.48 g/mol. Its IUPAC name is dipropan-2-yl (1R,2S,3R,4S,11R)-pentacyclo[9.6.0.01,4.05,10.012,17]heptadeca-5,7,9,12,14,16-hexaene-2,3-dicarboxylate.
| Compound Name | dipropan-2-yl (1R,2S,3R,4S,11R)-pentacyclo[9.6.0.01,4.05,10.012,17]heptadeca-5,7,9,12,14,16-hexaene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11862061 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | dipropan-2-yl (1R,2S,3R,4S,11R)-pentacyclo[9.6.0.01,4.05,10.012,17]heptadeca-5,7,9,12,14,16-hexaene-2,3-dicarboxylate |
| SMILES | CC(C)OC(=O)[C@@H]1[C@H]2c3ccccc3[C@@H]3c4ccccc4[C@@]32[C@H]1C(=O)OC(C)C |
| InChI | InChI=1S/C25H26O4/c1-13(2)28-23(26)19-21-16-10-6-5-9-15(16)20-17-11-7-8-12-18(17)25(20,21)22(19)24(27)29-14(3)4/h5-14,19-22H,1-4H3/t19-,20-,21-,22-,25-/m1/s1 |
| InChIKey | FCIKFEZCAYHCKX-ANOZEODCSA-N |
| XLogP | 4.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |