C33H51NO6 — CID 118620621
[6,6,9-trimethyl-3-(2-methyl-8-nitrooxyoctan-2-yl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 2-propylpentanoate (PubChem CID 118620621) has the molecular formula C33H51NO6 and a molecular weight of 557.77 g/mol. Its IUPAC name is [6,6,9-trimethyl-3-(2-methyl-8-nitrooxyoctan-2-yl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 2-propylpentanoate.
| Compound Name | [6,6,9-trimethyl-3-(2-methyl-8-nitrooxyoctan-2-yl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 2-propylpentanoate |
|---|---|
| PubChem CID | 118620621 |
| Molecular Formula | C33H51NO6 |
| Molecular Weight | 557.77 g/mol |
| Exact Mass | 557.37 |
| IUPAC Name | [6,6,9-trimethyl-3-(2-methyl-8-nitrooxyoctan-2-yl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-yl] 2-propylpentanoate |
| SMILES | CCCC(CCC)C(=O)Oc1cc(C(C)(C)CCCCCCO[N+](=O)[O-])cc2c1C1C=C(C)CCC1C(C)(C)O2 |
| InChI | InChI=1S/C33H51NO6/c1-8-14-24(15-9-2)31(35)39-28-21-25(32(4,5)18-12-10-11-13-19-38-34(36)37)22-29-30(28)26-20-23(3)16-17-27(26)33(6,7)40-29/h20-22,24,26-27H,8-19H2,1-7H3 |
| InChIKey | YOTFRRIPCNVJFB-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.77 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|