About 5-pent-4-ynyl-1,3,4-thiadiazol-2-amine
5-pent-4-ynyl-1,3,4-thiadiazol-2-amine (PubChem CID 118620873) has the molecular formula C7H9N3S
and a molecular weight of 167.24 g/mol. Its IUPAC name is 5-pent-4-ynyl-1,3,4-thiadiazol-2-amine.
Molecular Properties
| Compound Name | 5-pent-4-ynyl-1,3,4-thiadiazol-2-amine |
| PubChem CID | 118620873 |
| Molecular Formula | C7H9N3S |
| Molecular Weight | 167.24 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 5-pent-4-ynyl-1,3,4-thiadiazol-2-amine |
| SMILES | C#CCCCc1nnc(N)s1 |
| InChI | InChI=1S/C7H9N3S/c1-2-3-4-5-6-9-10-7(8)11-6/h1H,3-5H2,(H2,8,10) |
| InChIKey | WVYXTXWNZOQZET-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-pent-4-ynyl-1,3,4-thiadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pent-4-ynyl-1,3,4-thiadiazol-2-amine?
The IUPAC name of 5-pent-4-ynyl-1,3,4-thiadiazol-2-amine (CID 118620873) is 5-pent-4-ynyl-1,3,4-thiadiazol-2-amine.
What is the SMILES notation for 5-pent-4-ynyl-1,3,4-thiadiazol-2-amine?
The canonical SMILES for 5-pent-4-ynyl-1,3,4-thiadiazol-2-amine is C#CCCCc1nnc(N)s1.
What is the InChIKey of 5-pent-4-ynyl-1,3,4-thiadiazol-2-amine?
The InChIKey is WVYXTXWNZOQZET-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3S/c1-2-3-4-5-6-9-10-7(8)11-6/h1H,3-5H2,(H2,8,10).
What are the key properties of 5-pent-4-ynyl-1,3,4-thiadiazol-2-amine?
5-pent-4-ynyl-1,3,4-thiadiazol-2-amine has a molecular weight of 167.24 g/mol, XLogP of 1.08, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pent-4-ynyl-1,3,4-thiadiazol-2-amine is sourced from PubChem (CID 118620873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).