C25H31N7O5 — CID 118621093
N-[6-[(9-hydroxy-1,8-dioxo-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazin-6-yl)methylamino]-6-oxohexyl]-2H-pyrazolo[3,4-b]pyridine-3-carboxamide (PubChem CID 118621093) has the molecular formula C25H31N7O5 and a molecular weight of 509.57 g/mol. Its IUPAC name is N-[6-[(9-hydroxy-1,8-dioxo-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazin-6-yl)methylamino]-6-oxohexyl]-2H-pyrazolo[3,4-b]pyridine-3-carboxamide.
| Compound Name | N-[6-[(9-hydroxy-1,8-dioxo-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazin-6-yl)methylamino]-6-oxohexyl]-2H-pyrazolo[3,4-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118621093 |
| Molecular Formula | C25H31N7O5 |
| Molecular Weight | 509.57 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | N-[6-[(9-hydroxy-1,8-dioxo-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazin-6-yl)methylamino]-6-oxohexyl]-2H-pyrazolo[3,4-b]pyridine-3-carboxamide |
| SMILES | CC(C)N1CCn2c(CNC(=O)CCCCCNC(=O)c3[nH]nc4ncccc34)cc(=O)c(O)c2C1=O |
| InChI | InChI=1S/C25H31N7O5/c1-15(2)31-11-12-32-16(13-18(33)22(35)21(32)25(31)37)14-28-19(34)8-4-3-5-9-27-24(36)20-17-7-6-10-26-23(17)30-29-20/h6-7,10,13,15,35H,3-5,8-9,11-12,14H2,1-2H3,(H,27,36)(H,28,34)(H,26,29,30) |
| InChIKey | NQEUARBITNIINT-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 162.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.57 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|