C20H19Cl2NO2 — CID 118622892
(2R,5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-prop-2-enylmorpholin-3-one (PubChem CID 118622892) has the molecular formula C20H19Cl2NO2 and a molecular weight of 376.28 g/mol. Its IUPAC name is (2R,5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-prop-2-enylmorpholin-3-one.
| Compound Name | (2R,5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-prop-2-enylmorpholin-3-one |
|---|---|
| PubChem CID | 118622892 |
| Molecular Formula | C20H19Cl2NO2 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | (2R,5S,6R)-5,6-bis(4-chlorophenyl)-4-methyl-2-prop-2-enylmorpholin-3-one |
| SMILES | C=CC[C@H]1O[C@H](c2ccc(Cl)cc2)[C@H](c2ccc(Cl)cc2)N(C)C1=O |
| InChI | InChI=1S/C20H19Cl2NO2/c1-3-4-17-20(24)23(2)18(13-5-9-15(21)10-6-13)19(25-17)14-7-11-16(22)12-8-14/h3,5-12,17-19H,1,4H2,2H3/t17-,18+,19-/m1/s1 |
| InChIKey | VFXTVQWUJMRXOV-CEXWTWQISA-N |
| XLogP | 5.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|