C27H22ClF3N2O5 — CID 118623067
(3R,3aR,6R,6aR)-6-[6-chloro-1-(hydroxymethyl)-5-(4-phenylphenyl)-3-(trifluoromethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 118623067) has the molecular formula C27H22ClF3N2O5 and a molecular weight of 546.93 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[6-chloro-1-(hydroxymethyl)-5-(4-phenylphenyl)-3-(trifluoromethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[6-chloro-1-(hydroxymethyl)-5-(4-phenylphenyl)-3-(trifluoromethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 118623067 |
| Molecular Formula | C27H22ClF3N2O5 |
| Molecular Weight | 546.93 g/mol |
| Exact Mass | 546.12 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[6-chloro-1-(hydroxymethyl)-5-(4-phenylphenyl)-3-(trifluoromethyl)pyrrolo[3,2-b]pyridin-2-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | OCn1c(O[C@@H]2CO[C@H]3[C@@H]2OC[C@H]3O)c(C(F)(F)F)c2nc(-c3ccc(-c4ccccc4)cc3)c(Cl)cc21 |
| InChI | InChI=1S/C27H22ClF3N2O5/c28-17-10-18-23(32-22(17)16-8-6-15(7-9-16)14-4-2-1-3-5-14)21(27(29,30)31)26(33(18)13-34)38-20-12-37-24-19(35)11-36-25(20)24/h1-10,19-20,24-25,34-35H,11-13H2/t19-,20-,24-,25-/m1/s1 |
| InChIKey | HZOZPTPOIUAXLQ-GQUJEBGOSA-N |
| XLogP | 4.90 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.93 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |