C20H23F2IN2O4 — CID 118624201
2-methylpropyl (4aR)-1-[(2,3-difluoro-4-iodophenyl)methyl]-4-hydroxy-4a-methyl-2-oxo-6,7-dihydro-5H-pyrrolo[1,2-b]pyridazine-3-carboxylate (PubChem CID 118624201) has the molecular formula C20H23F2IN2O4 and a molecular weight of 520.31 g/mol. Its IUPAC name is 2-methylpropyl (4aR)-1-[(2,3-difluoro-4-iodophenyl)methyl]-4-hydroxy-4a-methyl-2-oxo-6,7-dihydro-5H-pyrrolo[1,2-b]pyridazine-3-carboxylate.
| Compound Name | 2-methylpropyl (4aR)-1-[(2,3-difluoro-4-iodophenyl)methyl]-4-hydroxy-4a-methyl-2-oxo-6,7-dihydro-5H-pyrrolo[1,2-b]pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 118624201 |
| Molecular Formula | C20H23F2IN2O4 |
| Molecular Weight | 520.31 g/mol |
| Exact Mass | 520.07 |
| IUPAC Name | 2-methylpropyl (4aR)-1-[(2,3-difluoro-4-iodophenyl)methyl]-4-hydroxy-4a-methyl-2-oxo-6,7-dihydro-5H-pyrrolo[1,2-b]pyridazine-3-carboxylate |
| SMILES | CC(C)COC(=O)C1=C(O)[C@@]2(C)CCCN2N(Cc2ccc(I)c(F)c2F)C1=O |
| InChI | InChI=1S/C20H23F2IN2O4/c1-11(2)10-29-19(28)14-17(26)20(3)7-4-8-25(20)24(18(14)27)9-12-5-6-13(23)16(22)15(12)21/h5-6,11,26H,4,7-10H2,1-3H3/t20-/m1/s1 |
| InChIKey | FUZJICIEIMEVBM-HXUWFJFHSA-N |
| XLogP | 3.69 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|