C7H10N2O2 — CID 118624528
1,2,3,4,4a,7-hexahydropyrrolo[1,2-b]pyridazine-5,6-dione (PubChem CID 118624528) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 1,2,3,4,4a,7-hexahydropyrrolo[1,2-b]pyridazine-5,6-dione.
| Compound Name | 1,2,3,4,4a,7-hexahydropyrrolo[1,2-b]pyridazine-5,6-dione |
|---|---|
| PubChem CID | 118624528 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 1,2,3,4,4a,7-hexahydropyrrolo[1,2-b]pyridazine-5,6-dione |
| SMILES | O=C1CN2NCCCC2C1=O |
| InChI | InChI=1S/C7H10N2O2/c10-6-4-9-5(7(6)11)2-1-3-8-9/h5,8H,1-4H2 |
| InChIKey | WEFROVUETYTAJW-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|