C21H22N4S — CID 11862508
(1S,4S,4aR)-4-(5-butylthiophen-2-yl)-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile (PubChem CID 11862508) has the molecular formula C21H22N4S and a molecular weight of 362.50 g/mol. Its IUPAC name is (1S,4S,4aR)-4-(5-butylthiophen-2-yl)-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile.
| Compound Name | (1S,4S,4aR)-4-(5-butylthiophen-2-yl)-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile |
|---|---|
| PubChem CID | 11862508 |
| Molecular Formula | C21H22N4S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (1S,4S,4aR)-4-(5-butylthiophen-2-yl)-2-imino-1,4,4a,5,6,7-hexahydronaphthalene-1,3,3-tricarbonitrile |
| SMILES | [H]/N=C1\[C@@H](C#N)C2=CCCC[C@@H]2[C@H](c2ccc(CCCC)s2)C1(C#N)C#N |
| InChI | InChI=1S/C21H22N4S/c1-2-3-6-14-9-10-18(26-14)19-16-8-5-4-7-15(16)17(11-22)20(25)21(19,12-23)13-24/h7,9-10,16-17,19,25H,2-6,8H2,1H3/b25-20+/t16-,17-,19+/m0/s1 |
| InChIKey | CNYTVIYXIBENDD-PAVNWRKCSA-N |
| XLogP | 5.11 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|