C10H10BrCl2N5 — CID 118625468
1-(4-bromo-3,5-dichlorophenyl)-5-N,5-N-dimethyl-1,2,4-triazole-3,5-diamine (PubChem CID 118625468) has the molecular formula C10H10BrCl2N5 and a molecular weight of 351.04 g/mol. Its IUPAC name is 1-(4-bromo-3,5-dichlorophenyl)-5-N,5-N-dimethyl-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(4-bromo-3,5-dichlorophenyl)-5-N,5-N-dimethyl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 118625468 |
| Molecular Formula | C10H10BrCl2N5 |
| Molecular Weight | 351.04 g/mol |
| Exact Mass | 348.95 |
| IUPAC Name | 1-(4-bromo-3,5-dichlorophenyl)-5-N,5-N-dimethyl-1,2,4-triazole-3,5-diamine |
| SMILES | CN(C)c1nc(N)nn1-c1cc(Cl)c(Br)c(Cl)c1 |
| InChI | InChI=1S/C10H10BrCl2N5/c1-17(2)10-15-9(14)16-18(10)5-3-6(12)8(11)7(13)4-5/h3-4H,1-2H3,(H2,14,16) |
| InChIKey | XFWDUBZUYAAOMF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.04 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|