About 7-[4-[2-[(2S)-pyrrolidin-2-yl]ethyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one
7-[4-[2-[(2S)-pyrrolidin-2-yl]ethyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one (PubChem CID 118626171) has the molecular formula C17H24N4O2
and a molecular weight of 316.40 g/mol. Its IUPAC name is 7-[4-[2-[(2S)-pyrrolidin-2-yl]ethyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 7-[4-[2-[(2S)-pyrrolidin-2-yl]ethyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one |
| PubChem CID | 118626171 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 7-[4-[2-[(2S)-pyrrolidin-2-yl]ethyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cccc(N3CCN(CC[C@@H]4CCCN4)CC3)c2o1 |
| InChI | InChI=1S/C17H24N4O2/c22-17-19-14-4-1-5-15(16(14)23-17)21-11-9-20(10-12-21)8-6-13-3-2-7-18-13/h1,4-5,13,18H,2-3,6-12H2,(H,19,22)/t13-/m0/s1 |
| InChIKey | AHLCSQLDVXYGRZ-ZDUSSCGKSA-N |
| XLogP | 1.39 |
| TPSA | 64.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-[4-[2-[(2S)-pyrrolidin-2-yl]ethyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[4-[2-[(2S)-pyrrolidin-2-yl]ethyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one?
The IUPAC name of 7-[4-[2-[(2S)-pyrrolidin-2-yl]ethyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one (CID 118626171) is 7-[4-[2-[(2S)-pyrrolidin-2-yl]ethyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one.
What is the SMILES notation for 7-[4-[2-[(2S)-pyrrolidin-2-yl]ethyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one?
The canonical SMILES for 7-[4-[2-[(2S)-pyrrolidin-2-yl]ethyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one is O=c1[nH]c2cccc(N3CCN(CC[C@@H]4CCCN4)CC3)c2o1.
What is the InChIKey of 7-[4-[2-[(2S)-pyrrolidin-2-yl]ethyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one?
The InChIKey is AHLCSQLDVXYGRZ-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H24N4O2/c22-17-19-14-4-1-5-15(16(14)23-17)21-11-9-20(10-12-21)8-6-13-3-2-7-18-13/h1,4-5,13,18H,2-3,6-12H2,(H,19,22)/t13-/m0/s1.
What are the key properties of 7-[4-[2-[(2S)-pyrrolidin-2-yl]ethyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one?
7-[4-[2-[(2S)-pyrrolidin-2-yl]ethyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one has a molecular weight of 316.40 g/mol, XLogP of 1.39, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[4-[2-[(2S)-pyrrolidin-2-yl]ethyl]piperazin-1-yl]-3H-1,3-benzoxazol-2-one is sourced from PubChem (CID 118626171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).