C13H18N2 — CID 118626252
3-ethyl-4-(1,2,3,6-tetrahydropyridin-4-yl)aniline (PubChem CID 118626252) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 3-ethyl-4-(1,2,3,6-tetrahydropyridin-4-yl)aniline.
| Compound Name | 3-ethyl-4-(1,2,3,6-tetrahydropyridin-4-yl)aniline |
|---|---|
| PubChem CID | 118626252 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 3-ethyl-4-(1,2,3,6-tetrahydropyridin-4-yl)aniline |
| SMILES | CCc1cc(N)ccc1C1=CCNCC1 |
| InChI | InChI=1S/C13H18N2/c1-2-10-9-12(14)3-4-13(10)11-5-7-15-8-6-11/h3-5,9,15H,2,6-8,14H2,1H3 |
| InChIKey | GLRHSWFMPGFATJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|