C23H28N8O3 — CID 118626788
1-[4-[6-[[2-(4-cyclobutyloxy-2-pyridinyl)acetyl]amino]pyridazin-3-yl]butyl]-N-methyltriazole-4-carboxamide (PubChem CID 118626788) has the molecular formula C23H28N8O3 and a molecular weight of 464.53 g/mol. Its IUPAC name is 1-[4-[6-[[2-(4-cyclobutyloxy-2-pyridinyl)acetyl]amino]pyridazin-3-yl]butyl]-N-methyltriazole-4-carboxamide.
| Compound Name | 1-[4-[6-[[2-(4-cyclobutyloxy-2-pyridinyl)acetyl]amino]pyridazin-3-yl]butyl]-N-methyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 118626788 |
| Molecular Formula | C23H28N8O3 |
| Molecular Weight | 464.53 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 1-[4-[6-[[2-(4-cyclobutyloxy-2-pyridinyl)acetyl]amino]pyridazin-3-yl]butyl]-N-methyltriazole-4-carboxamide |
| SMILES | CNC(=O)c1cn(CCCCc2ccc(NC(=O)Cc3cc(OC4CCC4)ccn3)nn2)nn1 |
| InChI | InChI=1S/C23H28N8O3/c1-24-23(33)20-15-31(30-28-20)12-3-2-5-16-8-9-21(29-27-16)26-22(32)14-17-13-19(10-11-25-17)34-18-6-4-7-18/h8-11,13,15,18H,2-7,12,14H2,1H3,(H,24,33)(H,26,29,32) |
| InChIKey | PESAWHFVOHIWKH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 136.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.53 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|