C20H18F6N2O — CID 118627059
(3S,4S)-4-[3,6-bis(trifluoromethyl)carbazol-9-yl]azepan-3-ol (PubChem CID 118627059) has the molecular formula C20H18F6N2O and a molecular weight of 416.37 g/mol. Its IUPAC name is (3S,4S)-4-[3,6-bis(trifluoromethyl)carbazol-9-yl]azepan-3-ol.
| Compound Name | (3S,4S)-4-[3,6-bis(trifluoromethyl)carbazol-9-yl]azepan-3-ol |
|---|---|
| PubChem CID | 118627059 |
| Molecular Formula | C20H18F6N2O |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | (3S,4S)-4-[3,6-bis(trifluoromethyl)carbazol-9-yl]azepan-3-ol |
| SMILES | O[C@H]1CNCCC[C@@H]1n1c2ccc(C(F)(F)F)cc2c2cc(C(F)(F)F)ccc21 |
| InChI | InChI=1S/C20H18F6N2O/c21-19(22,23)11-3-5-15-13(8-11)14-9-12(20(24,25)26)4-6-16(14)28(15)17-2-1-7-27-10-18(17)29/h3-6,8-9,17-18,27,29H,1-2,7,10H2/t17-,18-/m0/s1 |
| InChIKey | SCGIPTPYXPTGLO-ROUUACIJSA-N |
| XLogP | 5.12 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |