C27H28N2O7 — CID 118627086
1,8b-dihydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carbohydrazide (PubChem CID 118627086) has the molecular formula C27H28N2O7 and a molecular weight of 492.53 g/mol. Its IUPAC name is 1,8b-dihydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carbohydrazide.
| Compound Name | 1,8b-dihydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 118627086 |
| Molecular Formula | C27H28N2O7 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 1,8b-dihydroxy-6,8-dimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carbohydrazide |
| SMILES | COc1ccc(C23Oc4cc(OC)cc(OC)c4C2(O)C(O)C(C(=O)NN)C3c2ccccc2)cc1 |
| InChI | InChI=1S/C27H28N2O7/c1-33-17-11-9-16(10-12-17)27-22(15-7-5-4-6-8-15)21(25(31)29-28)24(30)26(27,32)23-19(35-3)13-18(34-2)14-20(23)36-27/h4-14,21-22,24,30,32H,28H2,1-3H3,(H,29,31) |
| InChIKey | NPMDSAGXZLIMLK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|