C27H24N2O6 — CID 118627115
(1S,9R,10R)-1-hydroxy-3,5-dimethoxy-9-(4-methoxyphenyl)-10-phenyl-8-oxa-13,14-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2(7),3,5,11(15)-tetraen-12-one (PubChem CID 118627115) has the molecular formula C27H24N2O6 and a molecular weight of 472.50 g/mol. Its IUPAC name is (1S,9R,10R)-1-hydroxy-3,5-dimethoxy-9-(4-methoxyphenyl)-10-phenyl-8-oxa-13,14-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2(7),3,5,11(15)-tetraen-12-one.
| Compound Name | (1S,9R,10R)-1-hydroxy-3,5-dimethoxy-9-(4-methoxyphenyl)-10-phenyl-8-oxa-13,14-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2(7),3,5,11(15)-tetraen-12-one |
|---|---|
| PubChem CID | 118627115 |
| Molecular Formula | C27H24N2O6 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | (1S,9R,10R)-1-hydroxy-3,5-dimethoxy-9-(4-methoxyphenyl)-10-phenyl-8-oxa-13,14-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-2(7),3,5,11(15)-tetraen-12-one |
| SMILES | COc1ccc([C@@]23Oc4cc(OC)cc(OC)c4[C@]2(O)c2[nH][nH]c(=O)c2[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C27H24N2O6/c1-32-17-11-9-16(10-12-17)27-22(15-7-5-4-6-8-15)21-24(28-29-25(21)30)26(27,31)23-19(34-3)13-18(33-2)14-20(23)35-27/h4-14,22,31H,1-3H3,(H2,28,29,30)/t22-,26+,27+/m1/s1 |
| InChIKey | CBZLCZCKWANMFW-ICTDUYRTSA-N |
| XLogP | 3.40 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |