C29H38N2O3 — CID 118627408
(3R,4S)-4-(2,3-dimethylphenoxy)piperidin-3-ol;4-(naphthalen-2-ylmethoxy)piperidine (PubChem CID 118627408) has the molecular formula C29H38N2O3 and a molecular weight of 462.63 g/mol. Its IUPAC name is (3R,4S)-4-(2,3-dimethylphenoxy)piperidin-3-ol;4-(naphthalen-2-ylmethoxy)piperidine.
| Compound Name | (3R,4S)-4-(2,3-dimethylphenoxy)piperidin-3-ol;4-(naphthalen-2-ylmethoxy)piperidine |
|---|---|
| PubChem CID | 118627408 |
| Molecular Formula | C29H38N2O3 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | (3R,4S)-4-(2,3-dimethylphenoxy)piperidin-3-ol;4-(naphthalen-2-ylmethoxy)piperidine |
| SMILES | Cc1cccc(O[C@H]2CCNC[C@H]2O)c1C.c1ccc2cc(COC3CCNCC3)ccc2c1 |
| InChI | InChI=1S/C16H19NO.C13H19NO2/c1-2-4-15-11-13(5-6-14(15)3-1)12-18-16-7-9-17-10-8-16;1-9-4-3-5-12(10(9)2)16-13-6-7-14-8-11(13)15/h1-6,11,16-17H,7-10,12H2;3-5,11,13-15H,6-8H2,1-2H3/t;11-,13+/m.1/s1 |
| InChIKey | SYDCZOKTZPZCDL-DVOMEGAOSA-N |
| XLogP | 4.51 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |