C15H14ClF3NO3P — CID 11862866
N-[(4-chlorophenoxy)-(2,2,2-trifluoroethoxy)phosphoryl]-4-methylaniline (PubChem CID 11862866) has the molecular formula C15H14ClF3NO3P and a molecular weight of 379.70 g/mol. Its IUPAC name is N-[(4-chlorophenoxy)-(2,2,2-trifluoroethoxy)phosphoryl]-4-methylaniline.
| Compound Name | N-[(4-chlorophenoxy)-(2,2,2-trifluoroethoxy)phosphoryl]-4-methylaniline |
|---|---|
| PubChem CID | 11862866 |
| Molecular Formula | C15H14ClF3NO3P |
| Molecular Weight | 379.70 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | N-[(4-chlorophenoxy)-(2,2,2-trifluoroethoxy)phosphoryl]-4-methylaniline |
| SMILES | Cc1ccc(N[P@](=O)(OCC(F)(F)F)Oc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C15H14ClF3NO3P/c1-11-2-6-13(7-3-11)20-24(21,22-10-15(17,18)19)23-14-8-4-12(16)5-9-14/h2-9H,10H2,1H3,(H,20,21)/t24-/m0/s1 |
| InChIKey | OFHFVTSEKPMTRQ-DEOSSOPVSA-N |
| XLogP | 5.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.70 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|