C23H26BrN5O6S2 — CID 118628888
[(1R,2R,3S,4R)-4-[[5-[4-[(1R)-1-amino-1-(3-bromophenyl)ethyl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate (PubChem CID 118628888) has the molecular formula C23H26BrN5O6S2 and a molecular weight of 612.53 g/mol. Its IUPAC name is [(1R,2R,3S,4R)-4-[[5-[4-[(1R)-1-amino-1-(3-bromophenyl)ethyl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2R,3S,4R)-4-[[5-[4-[(1R)-1-amino-1-(3-bromophenyl)ethyl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 118628888 |
| Molecular Formula | C23H26BrN5O6S2 |
| Molecular Weight | 612.53 g/mol |
| Exact Mass | 611.05 |
| IUPAC Name | [(1R,2R,3S,4R)-4-[[5-[4-[(1R)-1-amino-1-(3-bromophenyl)ethyl]thiophene-2-carbonyl]pyrimidin-4-yl]amino]-2,3-dihydroxycyclopentyl]methyl sulfamate |
| SMILES | C[C@@](N)(c1cccc(Br)c1)c1csc(C(=O)c2cncnc2N[C@@H]2C[C@H](COS(N)(=O)=O)[C@@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C23H26BrN5O6S2/c1-23(25,13-3-2-4-15(24)6-13)14-7-18(36-10-14)20(31)16-8-27-11-28-22(16)29-17-5-12(19(30)21(17)32)9-35-37(26,33)34/h2-4,6-8,10-12,17,19,21,30,32H,5,9,25H2,1H3,(H2,26,33,34)(H,27,28,29)/t12-,17-,19-,21+,23-/m1/s1 |
| InChIKey | PKZKPEKAHPGUEO-BDRLQPNQSA-N |
| XLogP | 1.50 |
| TPSA | 190.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.53 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |