C25H27ClN4O6S2 — CID 118629007
[(1R,2S,4R)-4-[[5-[4-(7-chloro-3,4-dihydro-1H-isochromen-1-yl)-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate (PubChem CID 118629007) has the molecular formula C25H27ClN4O6S2 and a molecular weight of 579.10 g/mol. Its IUPAC name is [(1R,2S,4R)-4-[[5-[4-(7-chloro-3,4-dihydro-1H-isochromen-1-yl)-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate.
| Compound Name | [(1R,2S,4R)-4-[[5-[4-(7-chloro-3,4-dihydro-1H-isochromen-1-yl)-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate |
|---|---|
| PubChem CID | 118629007 |
| Molecular Formula | C25H27ClN4O6S2 |
| Molecular Weight | 579.10 g/mol |
| Exact Mass | 578.11 |
| IUPAC Name | [(1R,2S,4R)-4-[[5-[4-(7-chloro-3,4-dihydro-1H-isochromen-1-yl)-5-methylthiophene-2-carbonyl]pyrimidin-4-yl]amino]-2-hydroxycyclopentyl]methyl sulfamate |
| SMILES | Cc1sc(C(=O)c2cncnc2N[C@@H]2C[C@H](COS(N)(=O)=O)[C@@H](O)C2)cc1C1OCCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C25H27ClN4O6S2/c1-13-18(24-19-7-16(26)3-2-14(19)4-5-35-24)9-22(37-13)23(32)20-10-28-12-29-25(20)30-17-6-15(21(31)8-17)11-36-38(27,33)34/h2-3,7,9-10,12,15,17,21,24,31H,4-6,8,11H2,1H3,(H2,27,33,34)(H,28,29,30)/t15-,17-,21+,24?/m1/s1 |
| InChIKey | HKIARJIHQHADQP-MHPKPXDFSA-N |
| XLogP | 3.16 |
| TPSA | 153.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.10 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |