About N',N'-bis[2-(aminodiazenyl)ethyl]ethane-1,2-diamine
N',N'-bis[2-(aminodiazenyl)ethyl]ethane-1,2-diamine (PubChem CID 118629316) has the molecular formula C6H18N8
and a molecular weight of 202.27 g/mol. Its IUPAC name is N',N'-bis[2-(aminodiazenyl)ethyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N',N'-bis[2-(aminodiazenyl)ethyl]ethane-1,2-diamine |
| PubChem CID | 118629316 |
| Molecular Formula | C6H18N8 |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | N',N'-bis[2-(aminodiazenyl)ethyl]ethane-1,2-diamine |
| SMILES | NCCN(CC/N=N/N)CC/N=N/N |
| InChI | InChI=1S/C6H18N8/c7-1-4-14(5-2-10-12-8)6-3-11-13-9/h1-7H2,(H2,8,10)(H2,9,11) |
| InChIKey | KOURFMSHDOOVGM-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 130.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N',N'-bis[2-(aminodiazenyl)ethyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-bis[2-(aminodiazenyl)ethyl]ethane-1,2-diamine?
The IUPAC name of N',N'-bis[2-(aminodiazenyl)ethyl]ethane-1,2-diamine (CID 118629316) is N',N'-bis[2-(aminodiazenyl)ethyl]ethane-1,2-diamine.
What is the SMILES notation for N',N'-bis[2-(aminodiazenyl)ethyl]ethane-1,2-diamine?
The canonical SMILES for N',N'-bis[2-(aminodiazenyl)ethyl]ethane-1,2-diamine is NCCN(CC/N=N/N)CC/N=N/N.
What is the InChIKey of N',N'-bis[2-(aminodiazenyl)ethyl]ethane-1,2-diamine?
The InChIKey is KOURFMSHDOOVGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H18N8/c7-1-4-14(5-2-10-12-8)6-3-11-13-9/h1-7H2,(H2,8,10)(H2,9,11).
What are the key properties of N',N'-bis[2-(aminodiazenyl)ethyl]ethane-1,2-diamine?
N',N'-bis[2-(aminodiazenyl)ethyl]ethane-1,2-diamine has a molecular weight of 202.27 g/mol, XLogP of -1.10, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-bis[2-(aminodiazenyl)ethyl]ethane-1,2-diamine is sourced from PubChem (CID 118629316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).