C23H26O4S — CID 118629929
13-[(1,1-dioxothian-4-yl)methoxy]-15-methyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-4-carbaldehyde (PubChem CID 118629929) has the molecular formula C23H26O4S and a molecular weight of 398.52 g/mol. Its IUPAC name is 13-[(1,1-dioxothian-4-yl)methoxy]-15-methyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-4-carbaldehyde.
| Compound Name | 13-[(1,1-dioxothian-4-yl)methoxy]-15-methyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-4-carbaldehyde |
|---|---|
| PubChem CID | 118629929 |
| Molecular Formula | C23H26O4S |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 13-[(1,1-dioxothian-4-yl)methoxy]-15-methyltricyclo[9.4.0.02,7]pentadeca-1(11),2(7),3,5,12,14-hexaene-4-carbaldehyde |
| SMILES | Cc1cc(OCC2CCS(=O)(=O)CC2)cc2c1-c1cc(C=O)ccc1CCC2 |
| InChI | InChI=1S/C23H26O4S/c1-16-11-21(27-15-17-7-9-28(25,26)10-8-17)13-20-4-2-3-19-6-5-18(14-24)12-22(19)23(16)20/h5-6,11-14,17H,2-4,7-10,15H2,1H3 |
| InChIKey | QMCVVVQTSPGZDZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|