C32H34N4O5S — CID 118630152
7-ethoxy-4-(4-methylphenyl)sulfonyl-5,11-diphenyl-3-propan-2-yl-1,4,9,11-tetrazatricyclo[7.3.0.02,6]dodec-6-ene-10,12-dione (PubChem CID 118630152) has the molecular formula C32H34N4O5S and a molecular weight of 586.71 g/mol. Its IUPAC name is 7-ethoxy-4-(4-methylphenyl)sulfonyl-5,11-diphenyl-3-propan-2-yl-1,4,9,11-tetrazatricyclo[7.3.0.02,6]dodec-6-ene-10,12-dione.
| Compound Name | 7-ethoxy-4-(4-methylphenyl)sulfonyl-5,11-diphenyl-3-propan-2-yl-1,4,9,11-tetrazatricyclo[7.3.0.02,6]dodec-6-ene-10,12-dione |
|---|---|
| PubChem CID | 118630152 |
| Molecular Formula | C32H34N4O5S |
| Molecular Weight | 586.71 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | 7-ethoxy-4-(4-methylphenyl)sulfonyl-5,11-diphenyl-3-propan-2-yl-1,4,9,11-tetrazatricyclo[7.3.0.02,6]dodec-6-ene-10,12-dione |
| SMILES | CCOC1=C2C(c3ccccc3)N(S(=O)(=O)c3ccc(C)cc3)C(C(C)C)C2n2c(=O)n(-c3ccccc3)c(=O)n2C1 |
| InChI | InChI=1S/C32H34N4O5S/c1-5-41-26-20-33-31(37)34(24-14-10-7-11-15-24)32(38)35(33)30-27(26)29(23-12-8-6-9-13-23)36(28(30)21(2)3)42(39,40)25-18-16-22(4)17-19-25/h6-19,21,28-30H,5,20H2,1-4H3 |
| InChIKey | ICBFGOJXNQRRRD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 95.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.71 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |