C36H35FO6S2 — CID 118630165
(3S,4aS,6S,8aR)-7-(benzenesulfonyl)-3-(2-fluorophenyl)-6-(4-methoxyphenyl)-4-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one (PubChem CID 118630165) has the molecular formula C36H35FO6S2 and a molecular weight of 646.80 g/mol. Its IUPAC name is (3S,4aS,6S,8aR)-7-(benzenesulfonyl)-3-(2-fluorophenyl)-6-(4-methoxyphenyl)-4-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one.
| Compound Name | (3S,4aS,6S,8aR)-7-(benzenesulfonyl)-3-(2-fluorophenyl)-6-(4-methoxyphenyl)-4-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 118630165 |
| Molecular Formula | C36H35FO6S2 |
| Molecular Weight | 646.80 g/mol |
| Exact Mass | 646.19 |
| IUPAC Name | (3S,4aS,6S,8aR)-7-(benzenesulfonyl)-3-(2-fluorophenyl)-6-(4-methoxyphenyl)-4-(4-methylphenyl)sulfonyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one |
| SMILES | COc1ccc([C@@H]2C[C@@H]3C(S(=O)(=O)c4ccc(C)cc4)[C@H](c4ccccc4F)CC(=O)[C@@H]3CC2S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H35FO6S2/c1-23-12-18-27(19-13-23)45(41,42)36-31-20-29(24-14-16-25(43-2)17-15-24)35(44(39,40)26-8-4-3-5-9-26)22-30(31)34(38)21-32(36)28-10-6-7-11-33(28)37/h3-19,29-32,35-36H,20-22H2,1-2H3/t29-,30+,31-,32-,35?,36?/m0/s1 |
| InChIKey | ZYPYBHDYUYBHFT-MVRJTQDGSA-N |
| XLogP | 6.69 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.80 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |