C21H41IO — CID 118630608
(3R,9S)-1-[(4R)-3,4-dimethylcyclohexyl]-8-iodo-3,9-dimethylundecan-4-ol (PubChem CID 118630608) has the molecular formula C21H41IO and a molecular weight of 436.46 g/mol. Its IUPAC name is (3R,9S)-1-[(4R)-3,4-dimethylcyclohexyl]-8-iodo-3,9-dimethylundecan-4-ol.
| Compound Name | (3R,9S)-1-[(4R)-3,4-dimethylcyclohexyl]-8-iodo-3,9-dimethylundecan-4-ol |
|---|---|
| PubChem CID | 118630608 |
| Molecular Formula | C21H41IO |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (3R,9S)-1-[(4R)-3,4-dimethylcyclohexyl]-8-iodo-3,9-dimethylundecan-4-ol |
| SMILES | CC[C@H](C)C(I)CCCC(O)[C@H](C)CCC1CC[C@@H](C)C(C)C1 |
| InChI | InChI=1S/C21H41IO/c1-6-15(2)20(22)8-7-9-21(23)17(4)11-13-19-12-10-16(3)18(5)14-19/h15-21,23H,6-14H2,1-5H3/t15-,16+,17+,18?,19?,20?,21?/m0/s1 |
| InChIKey | CPKRYXPJJMOAJM-RHCQMFQBSA-N |
| XLogP | 6.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|