C64H80N6 — CID 118631004
1-N,3-N-bis[2,5-bis[4-(dimethylamino)phenyl]-3-methylphenyl]-1-N,3-N-dihexylbenzene-1,3-diamine (PubChem CID 118631004) has the molecular formula C64H80N6 and a molecular weight of 933.39 g/mol. Its IUPAC name is 1-N,3-N-bis[2,5-bis[4-(dimethylamino)phenyl]-3-methylphenyl]-1-N,3-N-dihexylbenzene-1,3-diamine.
| Compound Name | 1-N,3-N-bis[2,5-bis[4-(dimethylamino)phenyl]-3-methylphenyl]-1-N,3-N-dihexylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 118631004 |
| Molecular Formula | C64H80N6 |
| Molecular Weight | 933.39 g/mol |
| Exact Mass | 932.64 |
| IUPAC Name | 1-N,3-N-bis[2,5-bis[4-(dimethylamino)phenyl]-3-methylphenyl]-1-N,3-N-dihexylbenzene-1,3-diamine |
| SMILES | CCCCCCN(c1cccc(N(CCCCCC)c2cc(-c3ccc(N(C)C)cc3)cc(C)c2-c2ccc(N(C)C)cc2)c1)c1cc(-c2ccc(N(C)C)cc2)cc(C)c1-c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C64H80N6/c1-13-15-17-19-40-69(61-44-53(49-24-32-55(33-25-49)65(5)6)42-47(3)63(61)51-28-36-57(37-29-51)67(9)10)59-22-21-23-60(46-59)70(41-20-18-16-14-2)62-45-54(50-26-34-56(35-27-50)66(7)8)43-48(4)64(62)52-30-38-58(39-31-52)68(11)12/h21-39,42-46H,13-20,40-41H2,1-12H3 |
| InChIKey | DLUAPPZUSQFCIX-UHFFFAOYSA-N |
| XLogP | 16.67 |
| TPSA | 19.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 933.39 |
| LogP ≤ 5 | 16.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|