C20H24ClN3O — CID 118631131
2-(4-chlorophenyl)-8-heptyl-7-methylimidazo[1,2-a]pyrimidin-5-one (PubChem CID 118631131) has the molecular formula C20H24ClN3O and a molecular weight of 357.89 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-8-heptyl-7-methylimidazo[1,2-a]pyrimidin-5-one.
| Compound Name | 2-(4-chlorophenyl)-8-heptyl-7-methylimidazo[1,2-a]pyrimidin-5-one |
|---|---|
| PubChem CID | 118631131 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 2-(4-chlorophenyl)-8-heptyl-7-methylimidazo[1,2-a]pyrimidin-5-one |
| SMILES | CCCCCCCn1c(C)cc(=O)n2cc(-c3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C20H24ClN3O/c1-3-4-5-6-7-12-23-15(2)13-19(25)24-14-18(22-20(23)24)16-8-10-17(21)11-9-16/h8-11,13-14H,3-7,12H2,1-2H3 |
| InChIKey | BIHJIEXMQHTXCC-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|