About 2-(4-chlorophenyl)-8-hexyl-7-methylimidazo[1,2-a]pyrimidin-5-one
2-(4-chlorophenyl)-8-hexyl-7-methylimidazo[1,2-a]pyrimidin-5-one (PubChem CID 118631137) has the molecular formula C19H22ClN3O
and a molecular weight of 343.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-8-hexyl-7-methylimidazo[1,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-8-hexyl-7-methylimidazo[1,2-a]pyrimidin-5-one |
| PubChem CID | 118631137 |
| Molecular Formula | C19H22ClN3O |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-(4-chlorophenyl)-8-hexyl-7-methylimidazo[1,2-a]pyrimidin-5-one |
| SMILES | CCCCCCn1c(C)cc(=O)n2cc(-c3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C19H22ClN3O/c1-3-4-5-6-11-22-14(2)12-18(24)23-13-17(21-19(22)23)15-7-9-16(20)10-8-15/h7-10,12-13H,3-6,11H2,1-2H3 |
| InChIKey | OWTFSGLQJCWBNH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)-8-hexyl-7-methylimidazo[1,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-8-hexyl-7-methylimidazo[1,2-a]pyrimidin-5-one?
The IUPAC name of 2-(4-chlorophenyl)-8-hexyl-7-methylimidazo[1,2-a]pyrimidin-5-one (CID 118631137) is 2-(4-chlorophenyl)-8-hexyl-7-methylimidazo[1,2-a]pyrimidin-5-one.
What is the SMILES notation for 2-(4-chlorophenyl)-8-hexyl-7-methylimidazo[1,2-a]pyrimidin-5-one?
The canonical SMILES for 2-(4-chlorophenyl)-8-hexyl-7-methylimidazo[1,2-a]pyrimidin-5-one is CCCCCCn1c(C)cc(=O)n2cc(-c3ccc(Cl)cc3)nc12.
What is the InChIKey of 2-(4-chlorophenyl)-8-hexyl-7-methylimidazo[1,2-a]pyrimidin-5-one?
The InChIKey is OWTFSGLQJCWBNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22ClN3O/c1-3-4-5-6-11-22-14(2)12-18(24)23-13-17(21-19(22)23)15-7-9-16(20)10-8-15/h7-10,12-13H,3-6,11H2,1-2H3.
What are the key properties of 2-(4-chlorophenyl)-8-hexyl-7-methylimidazo[1,2-a]pyrimidin-5-one?
2-(4-chlorophenyl)-8-hexyl-7-methylimidazo[1,2-a]pyrimidin-5-one has a molecular weight of 343.86 g/mol, XLogP of 4.71, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-8-hexyl-7-methylimidazo[1,2-a]pyrimidin-5-one is sourced from PubChem (CID 118631137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).