About 2-(4-chlorophenyl)-7-(2,5-dimethylpyrrolidin-1-yl)-8-pentylimidazo[1,2-a]pyrimidin-5-one
2-(4-chlorophenyl)-7-(2,5-dimethylpyrrolidin-1-yl)-8-pentylimidazo[1,2-a]pyrimidin-5-one (PubChem CID 118631337) has the molecular formula C23H29ClN4O
and a molecular weight of 412.97 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-7-(2,5-dimethylpyrrolidin-1-yl)-8-pentylimidazo[1,2-a]pyrimidin-5-one.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-7-(2,5-dimethylpyrrolidin-1-yl)-8-pentylimidazo[1,2-a]pyrimidin-5-one |
| PubChem CID | 118631337 |
| Molecular Formula | C23H29ClN4O |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2-(4-chlorophenyl)-7-(2,5-dimethylpyrrolidin-1-yl)-8-pentylimidazo[1,2-a]pyrimidin-5-one |
| SMILES | CCCCCn1c(N2C(C)CCC2C)cc(=O)n2cc(-c3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C23H29ClN4O/c1-4-5-6-13-26-21(28-16(2)7-8-17(28)3)14-22(29)27-15-20(25-23(26)27)18-9-11-19(24)12-10-18/h9-12,14-17H,4-8,13H2,1-3H3 |
| InChIKey | UUZSLUVIWMIOJY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)-7-(2,5-dimethylpyrrolidin-1-yl)-8-pentylimidazo[1,2-a]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-7-(2,5-dimethylpyrrolidin-1-yl)-8-pentylimidazo[1,2-a]pyrimidin-5-one?
The IUPAC name of 2-(4-chlorophenyl)-7-(2,5-dimethylpyrrolidin-1-yl)-8-pentylimidazo[1,2-a]pyrimidin-5-one (CID 118631337) is 2-(4-chlorophenyl)-7-(2,5-dimethylpyrrolidin-1-yl)-8-pentylimidazo[1,2-a]pyrimidin-5-one.
What is the SMILES notation for 2-(4-chlorophenyl)-7-(2,5-dimethylpyrrolidin-1-yl)-8-pentylimidazo[1,2-a]pyrimidin-5-one?
The canonical SMILES for 2-(4-chlorophenyl)-7-(2,5-dimethylpyrrolidin-1-yl)-8-pentylimidazo[1,2-a]pyrimidin-5-one is CCCCCn1c(N2C(C)CCC2C)cc(=O)n2cc(-c3ccc(Cl)cc3)nc12.
What is the InChIKey of 2-(4-chlorophenyl)-7-(2,5-dimethylpyrrolidin-1-yl)-8-pentylimidazo[1,2-a]pyrimidin-5-one?
The InChIKey is UUZSLUVIWMIOJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29ClN4O/c1-4-5-6-13-26-21(28-16(2)7-8-17(28)3)14-22(29)27-15-20(25-23(26)27)18-9-11-19(24)12-10-18/h9-12,14-17H,4-8,13H2,1-3H3.
What are the key properties of 2-(4-chlorophenyl)-7-(2,5-dimethylpyrrolidin-1-yl)-8-pentylimidazo[1,2-a]pyrimidin-5-one?
2-(4-chlorophenyl)-7-(2,5-dimethylpyrrolidin-1-yl)-8-pentylimidazo[1,2-a]pyrimidin-5-one has a molecular weight of 412.97 g/mol, XLogP of 5.38, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-7-(2,5-dimethylpyrrolidin-1-yl)-8-pentylimidazo[1,2-a]pyrimidin-5-one is sourced from PubChem (CID 118631337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).